Organic acids and derivatives
Filtered Search Results
Tamoxifen Citrate, USP, 99-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 54965-24-1 Molecular Formula: C32H37NO8 Molecular Weight (g/mol): 563.65 MDL Number: MFCD00058321 InChI Key: FQZYTYWMLGAPFJ-OQKDUQJOSA-N IUPAC Name: (2-{4-[(1Z)-1,2-diphenylbut-1-en-1-yl]phenoxy}ethyl)dimethylamine; 2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O.CC\C(=C(/C1=CC=CC=C1)C1=CC=C(OCCN(C)C)C=C1)C1=CC=CC=C1
| CAS | 54965-24-1 |
|---|---|
| Molecular Weight (g/mol) | 563.65 |
| MDL Number | MFCD00058321 |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O.CC\C(=C(/C1=CC=CC=C1)C1=CC=C(OCCN(C)C)C=C1)C1=CC=CC=C1 |
| IUPAC Name | (2-{4-[(1Z)-1,2-diphenylbut-1-en-1-yl]phenoxy}ethyl)dimethylamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | FQZYTYWMLGAPFJ-OQKDUQJOSA-N |
| Molecular Formula | C32H37NO8 |
Sodium Potassium Tartrate, Tetrahydrate, Powder, FCC, 99-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 6381-59-5 Molecular Formula: C4H12KNaO10 Molecular Weight (g/mol): 282.22 InChI Key: VZOPRCCTKLAGPN-ZFJVMAEJSA-L IUPAC Name: potassium sodium (2R,3R)-2,3-dihydroxybutanedioate tetrahydrate SMILES: O.O.O.O.[Na+].[K+].O[C@H]([C@@H](O)C([O-])=O)C([O-])=O
| CAS | 6381-59-5 |
|---|---|
| Molecular Weight (g/mol) | 282.22 |
| SMILES | O.O.O.O.[Na+].[K+].O[C@H]([C@@H](O)C([O-])=O)C([O-])=O |
| IUPAC Name | potassium sodium (2R,3R)-2,3-dihydroxybutanedioate tetrahydrate |
| InChI Key | VZOPRCCTKLAGPN-ZFJVMAEJSA-L |
| Molecular Formula | C4H12KNaO10 |
4-Hydroxybutyl acrylate, 95%, stab. with ca 500ppm 4-methoxyphenol
CAS: 2478-10-6 MDL Number: MFCD00010261
| CAS | 2478-10-6 |
|---|---|
| MDL Number | MFCD00010261 |
1,4-Butanesultone, 99%
CAS: 1633-83-6 Molecular Formula: C4H8O3S Molecular Weight (g/mol): 136.17 MDL Number: MFCD00006584 InChI Key: MHYFEEDKONKGEB-UHFFFAOYSA-N Synonym: 1,4-butane sultone,1,4-butanesultone,butane sultone,butanesultone,1,2-oxathiane, 2,2-dioxide,butanesulfone,1,2-oxathiane 2,2-dioxide,1,4-butylene sulfone,delta-valerosultone,1,4-butanesulfone PubChem CID: 15411 IUPAC Name: oxathiane 2,2-dioxide SMILES: O=S1(=O)CCCCO1
| PubChem CID | 15411 |
|---|---|
| CAS | 1633-83-6 |
| Molecular Weight (g/mol) | 136.17 |
| MDL Number | MFCD00006584 |
| SMILES | O=S1(=O)CCCCO1 |
| Synonym | 1,4-butane sultone,1,4-butanesultone,butane sultone,butanesultone,1,2-oxathiane, 2,2-dioxide,butanesulfone,1,2-oxathiane 2,2-dioxide,1,4-butylene sulfone,delta-valerosultone,1,4-butanesulfone |
| IUPAC Name | oxathiane 2,2-dioxide |
| InChI Key | MHYFEEDKONKGEB-UHFFFAOYSA-N |
| Molecular Formula | C4H8O3S |
Terephthalic dihydrazide, 95%
CAS: 136-64-1 Molecular Formula: C8H10N4O2 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00014762 InChI Key: ALHNLFMSAXZKRC-UHFFFAOYSA-N Synonym: terephthalic dihydrazide,terephthalohydrazide,terephthalic acid dihydrazide,terephthalic hydrazide,1,4-benzenedicarboxylic acid, dihydrazide,terephthaloyl dihydrazide,terephthalic acid bishydrazide,terephthalic acid, dihydrazide,terephthalhydrazide,terephthalicdihydrazide PubChem CID: 67294 IUPAC Name: benzene-1,4-dicarbohydrazide SMILES: NNC(=O)C1=CC=C(C=C1)C(=O)NN
| PubChem CID | 67294 |
|---|---|
| CAS | 136-64-1 |
| Molecular Weight (g/mol) | 194.19 |
| MDL Number | MFCD00014762 |
| SMILES | NNC(=O)C1=CC=C(C=C1)C(=O)NN |
| Synonym | terephthalic dihydrazide,terephthalohydrazide,terephthalic acid dihydrazide,terephthalic hydrazide,1,4-benzenedicarboxylic acid, dihydrazide,terephthaloyl dihydrazide,terephthalic acid bishydrazide,terephthalic acid, dihydrazide,terephthalhydrazide,terephthalicdihydrazide |
| IUPAC Name | benzene-1,4-dicarbohydrazide |
| InChI Key | ALHNLFMSAXZKRC-UHFFFAOYSA-N |
| Molecular Formula | C8H10N4O2 |
Biphenyl-4,4'-diboronic acid, 94%
CAS: 4151-80-8 Molecular Formula: C12H12B2O4 Molecular Weight (g/mol): 241.84 MDL Number: MFCD00151795 InChI Key: SLHKDOGTVUCXKX-UHFFFAOYSA-N Synonym: 4,4'-biphenyldiboronic acid,1,1'-biphenyl-4,4'-diyldiboronic acid,biphenyl-4,4'-diboronic acid,4-4-boronophenyl phenyl boronic acid,biphenyl-4,4'-diyldiboronic acid,pubchem5324,acmc-1apw8,4,4'-biphenyldiboric acid,4,4-biphenyldiboronic acid,4,4'-diboronobiphenyl PubChem CID: 2734608 IUPAC Name: [4-(4-boronophenyl)phenyl]boronic acid SMILES: OB(O)C1=CC=C(C=C1)C1=CC=C(C=C1)B(O)O
| PubChem CID | 2734608 |
|---|---|
| CAS | 4151-80-8 |
| Molecular Weight (g/mol) | 241.84 |
| MDL Number | MFCD00151795 |
| SMILES | OB(O)C1=CC=C(C=C1)C1=CC=C(C=C1)B(O)O |
| Synonym | 4,4'-biphenyldiboronic acid,1,1'-biphenyl-4,4'-diyldiboronic acid,biphenyl-4,4'-diboronic acid,4-4-boronophenyl phenyl boronic acid,biphenyl-4,4'-diyldiboronic acid,pubchem5324,acmc-1apw8,4,4'-biphenyldiboric acid,4,4-biphenyldiboronic acid,4,4'-diboronobiphenyl |
| IUPAC Name | [4-(4-boronophenyl)phenyl]boronic acid |
| InChI Key | SLHKDOGTVUCXKX-UHFFFAOYSA-N |
| Molecular Formula | C12H12B2O4 |
trans-Indole-3-acrylic acid, 98+%
CAS: 29953-71-7 Molecular Formula: C11H9NO2 Molecular Weight (g/mol): 187.198 MDL Number: MFCD00005633 InChI Key: PLVPPLCLBIEYEA-AATRIKPKSA-N Synonym: 3-indoleacrylic acid,trans-3-indoleacrylic acid,indole-3-acrylic acid,3-indolylacrylic acid,indole-3beta-acrylic acid,3-1h-indol-3-yl acrylic acid,indole-3-crylic acid,2e-3-1h-indol-3-yl prop-2-enoic acid,trans-3-1h-indol-3-yl acrylic acid,indoleacrylic acid van PubChem CID: 5375048 IUPAC Name: (E)-3-(1H-indol-3-yl)prop-2-enoic acid SMILES: C1=CC=C2C(=C1)C(=CN2)C=CC(=O)O
| PubChem CID | 5375048 |
|---|---|
| CAS | 29953-71-7 |
| Molecular Weight (g/mol) | 187.198 |
| MDL Number | MFCD00005633 |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C=CC(=O)O |
| Synonym | 3-indoleacrylic acid,trans-3-indoleacrylic acid,indole-3-acrylic acid,3-indolylacrylic acid,indole-3beta-acrylic acid,3-1h-indol-3-yl acrylic acid,indole-3-crylic acid,2e-3-1h-indol-3-yl prop-2-enoic acid,trans-3-1h-indol-3-yl acrylic acid,indoleacrylic acid van |
| IUPAC Name | (E)-3-(1H-indol-3-yl)prop-2-enoic acid |
| InChI Key | PLVPPLCLBIEYEA-AATRIKPKSA-N |
| Molecular Formula | C11H9NO2 |
Antipyrine, 99%
CAS: 60-80-0 Molecular Formula: C11H12N2O Molecular Weight (g/mol): 188.23 MDL Number: MFCD00003146 InChI Key: VEQOALNAAJBPNY-UHFFFAOYSA-N Synonym: antipyrine,phenazone,antipyrin,phenazon,analgesine,anodynine,anodynin,azophen,fenazone,2,3-dimethyl-1-phenyl-5-pyrazolone PubChem CID: 2206 ChEBI: CHEBI:31225 IUPAC Name: 1,5-dimethyl-2-phenylpyrazol-3-one SMILES: CC1=CC(=O)N(N1C)C2=CC=CC=C2
| PubChem CID | 2206 |
|---|---|
| CAS | 60-80-0 |
| Molecular Weight (g/mol) | 188.23 |
| ChEBI | CHEBI:31225 |
| MDL Number | MFCD00003146 |
| SMILES | CC1=CC(=O)N(N1C)C2=CC=CC=C2 |
| Synonym | antipyrine,phenazone,antipyrin,phenazon,analgesine,anodynine,anodynin,azophen,fenazone,2,3-dimethyl-1-phenyl-5-pyrazolone |
| IUPAC Name | 1,5-dimethyl-2-phenylpyrazol-3-one |
| InChI Key | VEQOALNAAJBPNY-UHFFFAOYSA-N |
| Molecular Formula | C11H12N2O |
Methyl Acetate, Technical, Approx. 75%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 79-20-9
| CAS | 79-20-9 |
|---|
methyl 4-amino-1-methyl-1H-pyrrole-2-carboxylate hydrochloride, Thermo Scientific™
CAS: 180258-45-1 Molecular Formula: C7H11ClN2O2 Molecular Weight (g/mol): 190.63 MDL Number: MFCD01318761 InChI Key: HEOKCJUUKIPIMM-UHFFFAOYSA-N Synonym: methyl 4-amino-1-methyl-1h-pyrrole-2-carboxylate hydrochloride,methyl 4-amino-1-methylpyrrole-2-carboxylate hydrochloride,methyl-4-amino-1-methyl pyrrole-2-carboxylate hydrochloride,4-amino-1-methyl-1h-pyrrole-2-carboxylic acid-methyl ester hcl,4-amino-1-methylpyrrole-2-carboxylic acid methyl ester hydrochloride,h-nh 4-mepyl-2-ome hcl,methyl 4-amino-1-methyl-pyrrole-2-carboxylate hydrochloride,methyl-4-amino-1-methyl pyrrole-2-carboxylate, hcl,n-methyl-2-carbomethoxy-4-aminopyrrole hydrochloride,3-amino-1-methyl-5-methyloxycarbonylpyrrol hydrochloride PubChem CID: 2794656 SMILES: Cl.COC(=O)C1=CC(N)=CN1C
| PubChem CID | 2794656 |
|---|---|
| CAS | 180258-45-1 |
| Molecular Weight (g/mol) | 190.63 |
| MDL Number | MFCD01318761 |
| SMILES | Cl.COC(=O)C1=CC(N)=CN1C |
| Synonym | methyl 4-amino-1-methyl-1h-pyrrole-2-carboxylate hydrochloride,methyl 4-amino-1-methylpyrrole-2-carboxylate hydrochloride,methyl-4-amino-1-methyl pyrrole-2-carboxylate hydrochloride,4-amino-1-methyl-1h-pyrrole-2-carboxylic acid-methyl ester hcl,4-amino-1-methylpyrrole-2-carboxylic acid methyl ester hydrochloride,h-nh 4-mepyl-2-ome hcl,methyl 4-amino-1-methyl-pyrrole-2-carboxylate hydrochloride,methyl-4-amino-1-methyl pyrrole-2-carboxylate, hcl,n-methyl-2-carbomethoxy-4-aminopyrrole hydrochloride,3-amino-1-methyl-5-methyloxycarbonylpyrrol hydrochloride |
| InChI Key | HEOKCJUUKIPIMM-UHFFFAOYSA-N |
| Molecular Formula | C7H11ClN2O2 |
N-Formylmorpholine, 99%
CAS: 4394-85-8 Molecular Formula: C5H9NO2 Molecular Weight (g/mol): 115.13 MDL Number: MFCD00006170 InChI Key: LCEDQNDDFOCWGG-UHFFFAOYSA-N Synonym: 4-formylmorpholine,n-formylmorpholine,4-morpholinecarboxaldehyde,morpholine, 4-formyl,n-formylmorfolin,4-morpholinecarbaldehyde,n-formylmorfolin czech,unii-d1e63xo4rh,n-formyhnorpholine,n-formyl morpholin PubChem CID: 20417 ChEBI: CHEBI:43989 IUPAC Name: morpholine-4-carbaldehyde SMILES: C1COCCN1C=O
| PubChem CID | 20417 |
|---|---|
| CAS | 4394-85-8 |
| Molecular Weight (g/mol) | 115.13 |
| ChEBI | CHEBI:43989 |
| MDL Number | MFCD00006170 |
| SMILES | C1COCCN1C=O |
| Synonym | 4-formylmorpholine,n-formylmorpholine,4-morpholinecarboxaldehyde,morpholine, 4-formyl,n-formylmorfolin,4-morpholinecarbaldehyde,n-formylmorfolin czech,unii-d1e63xo4rh,n-formyhnorpholine,n-formyl morpholin |
| IUPAC Name | morpholine-4-carbaldehyde |
| InChI Key | LCEDQNDDFOCWGG-UHFFFAOYSA-N |
| Molecular Formula | C5H9NO2 |
Diethyl sulfate, 99%
CAS: 64-67-5 Molecular Formula: C4H10O4S Molecular Weight (g/mol): 154.18 MDL Number: MFCD00009099 InChI Key: DENRZWYUOJLTMF-UHFFFAOYSA-N Synonym: sulfuric acid, diethyl ester,diethyl sulphate,diethylsulfate,diaethylsulfat,sulfuric acid diethyl ester,diethyl tetraoxosulfate,diaethylsulfat german,unii-k0fo4vfa7i,des van,diethylester kyseliny sirove PubChem CID: 6163 ChEBI: CHEBI:34699 IUPAC Name: diethyl sulfate SMILES: CCOS(=O)(=O)OCC
| PubChem CID | 6163 |
|---|---|
| CAS | 64-67-5 |
| Molecular Weight (g/mol) | 154.18 |
| ChEBI | CHEBI:34699 |
| MDL Number | MFCD00009099 |
| SMILES | CCOS(=O)(=O)OCC |
| Synonym | sulfuric acid, diethyl ester,diethyl sulphate,diethylsulfate,diaethylsulfat,sulfuric acid diethyl ester,diethyl tetraoxosulfate,diaethylsulfat german,unii-k0fo4vfa7i,des van,diethylester kyseliny sirove |
| IUPAC Name | diethyl sulfate |
| InChI Key | DENRZWYUOJLTMF-UHFFFAOYSA-N |
| Molecular Formula | C4H10O4S |
EDTA, Powder, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC Name: 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| IUPAC Name | 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |
MES, Sodium Salt, Purified, J.T. Baker™
CAS: 71119-23-8 Molecular Formula: C6H12NNaO4S Molecular Weight (g/mol): 217.215 InChI Key: IRHWMYKYLWNHTL-UHFFFAOYSA-M Synonym: mes sodium salt,sodium 2-morpholinoethanesulfonate,2-n-morpholino ethanesulfonic acid sodium salt,4-morpholineethanesulfonic acid, sodium salt,sodium 4-morpholin-1-ylethylsulphonate,sodium 2-4-morpholinyl ethanesulfonate,mes-na,4-morpholineethanesulfonic acid sodium salt,sodium 4-morpholineethanesulfonate,4-morpholineethanesulfonic acid, sodium salt 1:1 PubChem CID: 23673676 ChEBI: CHEBI:62955 IUPAC Name: sodium;2-morpholin-4-ylethanesulfonate SMILES: C1COCCN1CCS(=O)(=O)[O-].[Na+]
| PubChem CID | 23673676 |
|---|---|
| CAS | 71119-23-8 |
| Molecular Weight (g/mol) | 217.215 |
| ChEBI | CHEBI:62955 |
| SMILES | C1COCCN1CCS(=O)(=O)[O-].[Na+] |
| Synonym | mes sodium salt,sodium 2-morpholinoethanesulfonate,2-n-morpholino ethanesulfonic acid sodium salt,4-morpholineethanesulfonic acid, sodium salt,sodium 4-morpholin-1-ylethylsulphonate,sodium 2-4-morpholinyl ethanesulfonate,mes-na,4-morpholineethanesulfonic acid sodium salt,sodium 4-morpholineethanesulfonate,4-morpholineethanesulfonic acid, sodium salt 1:1 |
| IUPAC Name | sodium;2-morpholin-4-ylethanesulfonate |
| InChI Key | IRHWMYKYLWNHTL-UHFFFAOYSA-M |
| Molecular Formula | C6H12NNaO4S |
Cyclopropylboronic acid pinacol ester, 96%
CAS: 126689-01-8 Molecular Formula: C9H17BO2 Molecular Weight (g/mol): 168.04 MDL Number: MFCD05663847 InChI Key: XGBMQBPLWXTEPM-UHFFFAOYSA-N Synonym: cyclopropylboronic acid pinacol ester,cyclopropylboronic acid, pinacol ester,4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl cyclopropane,1,3,2-dioxaborolane, 2-cyclopropyl-4,4,5,5-tetramethyl,2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2 dioxaborolane,2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborol,cypbe,pubchem4015,pubchem7931,acmc-209bbh PubChem CID: 2758015 IUPAC Name: 2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane SMILES: CC1(C)OB(OC1(C)C)C1CC1
| PubChem CID | 2758015 |
|---|---|
| CAS | 126689-01-8 |
| Molecular Weight (g/mol) | 168.04 |
| MDL Number | MFCD05663847 |
| SMILES | CC1(C)OB(OC1(C)C)C1CC1 |
| Synonym | cyclopropylboronic acid pinacol ester,cyclopropylboronic acid, pinacol ester,4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl cyclopropane,1,3,2-dioxaborolane, 2-cyclopropyl-4,4,5,5-tetramethyl,2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2 dioxaborolane,2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborol,cypbe,pubchem4015,pubchem7931,acmc-209bbh |
| IUPAC Name | 2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChI Key | XGBMQBPLWXTEPM-UHFFFAOYSA-N |
| Molecular Formula | C9H17BO2 |